Other Solvents
Filtered Search Results
Deuterium chloride, for NMR, 1M solution in D2O, 99.8 atom% D, AcroSeal™
CAS: 7698-05-7 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00044642 InChI Key: VEXZGXHMUGYJMC-FTGQXOHASA-N Synonym: deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide PubChem CID: 522634 SMILES: Cl
| PubChem CID | 522634 |
|---|---|
| CAS | 7698-05-7 |
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00044642 |
| SMILES | Cl |
| Synonym | deuterium chloride,hydrochloric acid-d,deuterium chloride, 20 wt% in deuterium oxide,chlorohydrogen,hydrochloric acid d,chloro 2h,deuterium chloride, 99 atom % d,deuterium chloride, 1 m in deuterium oxide,deuterium chloride, 0.1 m in deuterium oxide,deuterium chloride, 38 wt% in deuterium oxide |
| InChI Key | VEXZGXHMUGYJMC-FTGQXOHASA-N |
| Molecular Formula | ClH |
3-Bromo-o-xylene, 99%, Thermo Scientific™
CAS: 576-23-8 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.06 MDL Number: MFCD00000069 InChI Key: WLPXNBYWDDYJTN-UHFFFAOYSA-N Synonym: 3-bromo-o-xylene,3-bromo-1,2-dimethylbenzene,2,3-dimethylbromobenzene,2,3-dimethyl bromobenzene,benzene, bromodimethyl,1-bromo-2,3-dimethyl-benzene,benzene, 1-bromo-2,3-dimethyl,bromoxilene,xylylbromid,bromo-o-xylene PubChem CID: 68472 IUPAC Name: 1-bromo-2,3-dimethylbenzene SMILES: CC1=CC=CC(Br)=C1C
| PubChem CID | 68472 |
|---|---|
| CAS | 576-23-8 |
| Molecular Weight (g/mol) | 185.06 |
| MDL Number | MFCD00000069 |
| SMILES | CC1=CC=CC(Br)=C1C |
| Synonym | 3-bromo-o-xylene,3-bromo-1,2-dimethylbenzene,2,3-dimethylbromobenzene,2,3-dimethyl bromobenzene,benzene, bromodimethyl,1-bromo-2,3-dimethyl-benzene,benzene, 1-bromo-2,3-dimethyl,bromoxilene,xylylbromid,bromo-o-xylene |
| IUPAC Name | 1-bromo-2,3-dimethylbenzene |
| InChI Key | WLPXNBYWDDYJTN-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
3-Chloroaniline, 99%
CAS: 108-42-9 Molecular Formula: C6H6ClN Molecular Weight (g/mol): 127.57 MDL Number: MFCD00007765 InChI Key: PNPCRKVUWYDDST-UHFFFAOYSA-N Synonym: m-chloroaniline,3-chlorobenzenamine,benzenamine, 3-chloro,m-chloraniline,3-chlorophenylamine,orange gc base,m-chlorophenylamine,m-aminochlorobenzene,m-chloroaminobenzene,aniline, m-chloro PubChem CID: 7932 IUPAC Name: 3-chloroaniline SMILES: NC1=CC=CC(Cl)=C1
| PubChem CID | 7932 |
|---|---|
| CAS | 108-42-9 |
| Molecular Weight (g/mol) | 127.57 |
| MDL Number | MFCD00007765 |
| SMILES | NC1=CC=CC(Cl)=C1 |
| Synonym | m-chloroaniline,3-chlorobenzenamine,benzenamine, 3-chloro,m-chloraniline,3-chlorophenylamine,orange gc base,m-chlorophenylamine,m-aminochlorobenzene,m-chloroaminobenzene,aniline, m-chloro |
| IUPAC Name | 3-chloroaniline |
| InChI Key | PNPCRKVUWYDDST-UHFFFAOYSA-N |
| Molecular Formula | C6H6ClN |
(S)-(+)-2-Butanol, 98+%
Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00064281 InChI Key: BTANRVKWQNVYAZ-BYPYZUCNSA-N Synonym: s-+-2-butanol,s-2-butanol,2s-butan-2-ol,s-butan-2-ol,s-+-sec-butanol,2s-2-butanol,unii-69kxu5ndto,s---2-butanol,s-+-sec-butyl alcohol PubChem CID: 444683 ChEBI: CHEBI:45475 IUPAC Name: (2S)-butan-2-ol SMILES: CCC(C)O
| PubChem CID | 444683 |
|---|---|
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:45475 |
| MDL Number | MFCD00064281 |
| SMILES | CCC(C)O |
| Synonym | s-+-2-butanol,s-2-butanol,2s-butan-2-ol,s-butan-2-ol,s-+-sec-butanol,2s-2-butanol,unii-69kxu5ndto,s---2-butanol,s-+-sec-butyl alcohol |
| IUPAC Name | (2S)-butan-2-ol |
| InChI Key | BTANRVKWQNVYAZ-BYPYZUCNSA-N |
| Molecular Formula | C4H10O |
2,2',5,5'-Tetramethylbiphenyl, 98%
CAS: 3075-84-1 Molecular Formula: C16H18 Molecular Weight (g/mol): 210.32 MDL Number: MFCD00151846 InChI Key: ZHTROMYSDSTCCE-UHFFFAOYSA-N PubChem CID: 137818 IUPAC Name: 2-(2,5-dimethylphenyl)-1,4-dimethylbenzene SMILES: CC1=CC=C(C)C(=C1)C1=CC(C)=CC=C1C
| PubChem CID | 137818 |
|---|---|
| CAS | 3075-84-1 |
| Molecular Weight (g/mol) | 210.32 |
| MDL Number | MFCD00151846 |
| SMILES | CC1=CC=C(C)C(=C1)C1=CC(C)=CC=C1C |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,4-dimethylbenzene |
| InChI Key | ZHTROMYSDSTCCE-UHFFFAOYSA-N |
| Molecular Formula | C16H18 |
EcoLite(+) Scintillation Cocktail, MP Biomedicals
All Purpose, Environmentally Safe, Biodegradable, Non-Toxic, Non-Flammable, Ready-to-Use, For RIA and Receptor Assays, Forms no gel or phasing
| Chemical Name or Material | EcoLite(+)™ Liquid Scintillation Cocktail |
|---|
2-Chloroaniline, 98+%
CAS: 95-51-2 Molecular Formula: C6H6ClN Molecular Weight (g/mol): 127.571 MDL Number: MFCD00007656 InChI Key: AKCRQHGQIJBRMN-UHFFFAOYSA-N Synonym: o-chloroaniline,benzenamine, 2-chloro,2-chlorobenzenamine,2-chlorophenylamine,1-amino-2-chlorobenzene,o-aminochlorobenzene,o-chloroaminobenzene,aniline, o-chloro,o-chloraniline,fast yellow gc base PubChem CID: 7240 IUPAC Name: 2-chloroaniline SMILES: C1=CC=C(C(=C1)N)Cl
| PubChem CID | 7240 |
|---|---|
| CAS | 95-51-2 |
| Molecular Weight (g/mol) | 127.571 |
| MDL Number | MFCD00007656 |
| SMILES | C1=CC=C(C(=C1)N)Cl |
| Synonym | o-chloroaniline,benzenamine, 2-chloro,2-chlorobenzenamine,2-chlorophenylamine,1-amino-2-chlorobenzene,o-aminochlorobenzene,o-chloroaminobenzene,aniline, o-chloro,o-chloraniline,fast yellow gc base |
| IUPAC Name | 2-chloroaniline |
| InChI Key | AKCRQHGQIJBRMN-UHFFFAOYSA-N |
| Molecular Formula | C6H6ClN |
2,5-Diphenyloxazole, 99%, scintillation grade
CAS: 92-71-7 Molecular Formula: C15H11NO Molecular Weight (g/mol): 221.26 MDL Number: MFCD00005306 InChI Key: CNRNYORZJGVOSY-UHFFFAOYSA-N Synonym: PPO PubChem CID: 7105 IUPAC Name: 2,5-diphenyl-1,3-oxazole SMILES: O1C(=CN=C1C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 7105 |
|---|---|
| CAS | 92-71-7 |
| Molecular Weight (g/mol) | 221.26 |
| MDL Number | MFCD00005306 |
| SMILES | O1C(=CN=C1C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | PPO |
| IUPAC Name | 2,5-diphenyl-1,3-oxazole |
| InChI Key | CNRNYORZJGVOSY-UHFFFAOYSA-N |
| Molecular Formula | C15H11NO |
3-Bromochlorobenzene, 99%
CAS: 108-37-2 Molecular Formula: C6H4BrCl Molecular Weight (g/mol): 191.45 MDL Number: MFCD00000568 InChI Key: JRGGUPZKKTVKOV-UHFFFAOYSA-N Synonym: 3-bromochlorobenzene,m-bromochlorobenzene,3-chlorobromobenzene,benzene, 1-bromo-3-chloro,m-chlorobromobenzene,1-chloro-3-bromobenzene,3-chlorophenyl bromide,m-chlorophenyl bromide,m-bromophenyl chloride,3-bromo-1-chlorobenzene PubChem CID: 7928 IUPAC Name: 1-bromo-3-chlorobenzene SMILES: ClC1=CC=CC(Br)=C1
| PubChem CID | 7928 |
|---|---|
| CAS | 108-37-2 |
| Molecular Weight (g/mol) | 191.45 |
| MDL Number | MFCD00000568 |
| SMILES | ClC1=CC=CC(Br)=C1 |
| Synonym | 3-bromochlorobenzene,m-bromochlorobenzene,3-chlorobromobenzene,benzene, 1-bromo-3-chloro,m-chlorobromobenzene,1-chloro-3-bromobenzene,3-chlorophenyl bromide,m-chlorophenyl bromide,m-bromophenyl chloride,3-bromo-1-chlorobenzene |
| IUPAC Name | 1-bromo-3-chlorobenzene |
| InChI Key | JRGGUPZKKTVKOV-UHFFFAOYSA-N |
| Molecular Formula | C6H4BrCl |
2-Chlorophenethylalcohol, 98%
CAS: 19819-95-5 Molecular Formula: C8H9ClO Molecular Weight (g/mol): 156.61 MDL Number: MFCD00002888 InChI Key: IWNHTCBFRSCBQK-UHFFFAOYSA-N Synonym: 2-2-chlorophenyl ethanol,2-chlorophenethyl alcohol,benzeneethanol, 2-chloro,2-chlorophenethylalcohol,2-2-chlorophenyl ethan-1-ol,o-chlorophenethyl alcohol,o-chlorophenethylic alcohol,o-chlorophenylmethylcarbinol,chlorobenzene-ethanol,2-chlorobenzeneethanol PubChem CID: 88266 IUPAC Name: 2-(2-chlorophenyl)ethanol SMILES: C1=CC=C(C(=C1)CCO)Cl
| PubChem CID | 88266 |
|---|---|
| CAS | 19819-95-5 |
| Molecular Weight (g/mol) | 156.61 |
| MDL Number | MFCD00002888 |
| SMILES | C1=CC=C(C(=C1)CCO)Cl |
| Synonym | 2-2-chlorophenyl ethanol,2-chlorophenethyl alcohol,benzeneethanol, 2-chloro,2-chlorophenethylalcohol,2-2-chlorophenyl ethan-1-ol,o-chlorophenethyl alcohol,o-chlorophenethylic alcohol,o-chlorophenylmethylcarbinol,chlorobenzene-ethanol,2-chlorobenzeneethanol |
| IUPAC Name | 2-(2-chlorophenyl)ethanol |
| InChI Key | IWNHTCBFRSCBQK-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO |
2,4-Dimethylbenzoic acid, 98%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Acetonitrile-d3, for NMR, packaged in 1.00 ml ampoules, 99.95 atom % D
CAS: 2206-26-0 Molecular Formula: C2H3N Molecular Weight (g/mol): 44.07 MDL Number: MFCD00001881 InChI Key: WEVYAHXRMPXWCK-FIBGUPNXSA-N Synonym: acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g PubChem CID: 123151 IUPAC Name: 2,2,2-trideuterioacetonitrile SMILES: [2H]C([2H])([2H])C#N
| PubChem CID | 123151 |
|---|---|
| CAS | 2206-26-0 |
| Molecular Weight (g/mol) | 44.07 |
| MDL Number | MFCD00001881 |
| SMILES | [2H]C([2H])([2H])C#N |
| Synonym | acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g |
| IUPAC Name | 2,2,2-trideuterioacetonitrile |
| InChI Key | WEVYAHXRMPXWCK-FIBGUPNXSA-N |
| Molecular Formula | C2H3N |
Acetonitrile-d3, for NMR, packaged in 0.75 ml ampoules, 99.9 atom % D
CAS: 2206-26-0 Molecular Formula: C2H3N Molecular Weight (g/mol): 44.07 MDL Number: MFCD00001881 InChI Key: WEVYAHXRMPXWCK-FIBGUPNXSA-N Synonym: acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g PubChem CID: 123151 IUPAC Name: 2,2,2-trideuterioacetonitrile SMILES: [2H]C([2H])([2H])C#N
| PubChem CID | 123151 |
|---|---|
| CAS | 2206-26-0 |
| Molecular Weight (g/mol) | 44.07 |
| MDL Number | MFCD00001881 |
| SMILES | [2H]C([2H])([2H])C#N |
| Synonym | acetonitrile-d3,2h3 acetonitrile,cd3cn,acetonitrile-2,2,2-d3,methyl-d3 cyanide,trideuteroacetonitrile,acetonitrile-d3, 99.8 atom % d,acetonitrile-d3, ≥99.8 atom % d,acetonitrile-d isotopic 5g |
| IUPAC Name | 2,2,2-trideuterioacetonitrile |
| InChI Key | WEVYAHXRMPXWCK-FIBGUPNXSA-N |
| Molecular Formula | C2H3N |
Cyclohexane, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards.
1,2-Dichloroethane, Purified, Spectrum™ Chemical
CAS: 107-06-2 Molecular Weight (g/mol): 98.96
| CAS | 107-06-2 |
|---|---|
| Molecular Weight (g/mol) | 98.96 |